C11H19NO3 — CID 62041313
4-methyl-4-(3-methylbut-2-enoylamino)pentanoic acid (PubChem CID 62041313) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-methyl-4-(3-methylbut-2-enoylamino)pentanoic acid.
| Compound Name | 4-methyl-4-(3-methylbut-2-enoylamino)pentanoic acid |
|---|---|
| PubChem CID | 62041313 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 4-methyl-4-(3-methylbut-2-enoylamino)pentanoic acid |
| SMILES | CC(C)=CC(=O)NC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C11H19NO3/c1-8(2)7-9(13)12-11(3,4)6-5-10(14)15/h7H,5-6H2,1-4H3,(H,12,13)(H,14,15) |
| InChIKey | NZMKZNOQOFNNJC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|