About 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methylpentanoic acid
4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methylpentanoic acid (PubChem CID 62041570) has the molecular formula C14H21N3O4
and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methylpentanoic acid.
Molecular Properties
| Compound Name | 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methylpentanoic acid |
| PubChem CID | 62041570 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methylpentanoic acid |
| SMILES | Cc1nc(=O)[nH]c(C)c1CC(=O)NC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C14H21N3O4/c1-8-10(9(2)16-13(21)15-8)7-11(18)17-14(3,4)6-5-12(19)20/h5-7H2,1-4H3,(H,17,18)(H,19,20)(H,15,16,21) |
| InChIKey | KHOMAGGDUJZBDK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methylpentanoic acid?
The IUPAC name of 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methylpentanoic acid (CID 62041570) is 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methylpentanoic acid.
What is the SMILES notation for 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methylpentanoic acid?
The canonical SMILES for 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methylpentanoic acid is Cc1nc(=O)[nH]c(C)c1CC(=O)NC(C)(C)CCC(=O)O.
What is the InChIKey of 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methylpentanoic acid?
The InChIKey is KHOMAGGDUJZBDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O4/c1-8-10(9(2)16-13(21)15-8)7-11(18)17-14(3,4)6-5-12(19)20/h5-7H2,1-4H3,(H,17,18)(H,19,20)(H,15,16,21).
What are the key properties of 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methylpentanoic acid?
4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methylpentanoic acid has a molecular weight of 295.34 g/mol, XLogP of 0.69, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methylpentanoic acid is sourced from PubChem (CID 62041570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).