C12H19N5 — CID 62041739
3-(7-methyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)-N-propan-2-ylpropan-1-amine (PubChem CID 62041739) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 3-(7-methyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-(7-methyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 62041739 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 3-(7-methyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)-N-propan-2-ylpropan-1-amine |
| SMILES | Cc1cc2nnc(CCCNC(C)C)n2cn1 |
| InChI | InChI=1S/C12H19N5/c1-9(2)13-6-4-5-11-15-16-12-7-10(3)14-8-17(11)12/h7-9,13H,4-6H2,1-3H3 |
| InChIKey | DVGWHPXBDLQWLN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|