C12H9F2N5 — CID 62042603
2,4-difluoro-5-(7-methyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)aniline (PubChem CID 62042603) has the molecular formula C12H9F2N5 and a molecular weight of 261.24 g/mol. Its IUPAC name is 2,4-difluoro-5-(7-methyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)aniline.
| Compound Name | 2,4-difluoro-5-(7-methyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)aniline |
|---|---|
| PubChem CID | 62042603 |
| Molecular Formula | C12H9F2N5 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2,4-difluoro-5-(7-methyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)aniline |
| SMILES | Cc1cc2nnc(-c3cc(N)c(F)cc3F)n2cn1 |
| InChI | InChI=1S/C12H9F2N5/c1-6-2-11-17-18-12(19(11)5-16-6)7-3-10(15)9(14)4-8(7)13/h2-5H,15H2,1H3 |
| InChIKey | DHBMWLHHWBUARB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|