C12H15BrN2O4 — CID 62043080
4-(2-bromo-4-nitroanilino)-4-methylpentanoic acid (PubChem CID 62043080) has the molecular formula C12H15BrN2O4 and a molecular weight of 331.17 g/mol. Its IUPAC name is 4-(2-bromo-4-nitroanilino)-4-methylpentanoic acid.
| Compound Name | 4-(2-bromo-4-nitroanilino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 62043080 |
| Molecular Formula | C12H15BrN2O4 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 4-(2-bromo-4-nitroanilino)-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C12H15BrN2O4/c1-12(2,6-5-11(16)17)14-10-4-3-8(15(18)19)7-9(10)13/h3-4,7,14H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | NCESXHVDKACKPQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|