About N-ethyl-1-(3,4,5-trimethylpyrazol-1-yl)pentan-2-amine
N-ethyl-1-(3,4,5-trimethylpyrazol-1-yl)pentan-2-amine (PubChem CID 62043193) has the molecular formula C13H25N3
and a molecular weight of 223.36 g/mol. Its IUPAC name is N-ethyl-1-(3,4,5-trimethylpyrazol-1-yl)pentan-2-amine.
Molecular Properties
| Compound Name | N-ethyl-1-(3,4,5-trimethylpyrazol-1-yl)pentan-2-amine |
| PubChem CID | 62043193 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | N-ethyl-1-(3,4,5-trimethylpyrazol-1-yl)pentan-2-amine |
| SMILES | CCCC(Cn1nc(C)c(C)c1C)NCC |
| InChI | InChI=1S/C13H25N3/c1-6-8-13(14-7-2)9-16-12(5)10(3)11(4)15-16/h13-14H,6-9H2,1-5H3 |
| InChIKey | HDJJXYZHRDFBMX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-1-(3,4,5-trimethylpyrazol-1-yl)pentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1-(3,4,5-trimethylpyrazol-1-yl)pentan-2-amine?
The IUPAC name of N-ethyl-1-(3,4,5-trimethylpyrazol-1-yl)pentan-2-amine (CID 62043193) is N-ethyl-1-(3,4,5-trimethylpyrazol-1-yl)pentan-2-amine.
What is the SMILES notation for N-ethyl-1-(3,4,5-trimethylpyrazol-1-yl)pentan-2-amine?
The canonical SMILES for N-ethyl-1-(3,4,5-trimethylpyrazol-1-yl)pentan-2-amine is CCCC(Cn1nc(C)c(C)c1C)NCC.
What is the InChIKey of N-ethyl-1-(3,4,5-trimethylpyrazol-1-yl)pentan-2-amine?
The InChIKey is HDJJXYZHRDFBMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3/c1-6-8-13(14-7-2)9-16-12(5)10(3)11(4)15-16/h13-14H,6-9H2,1-5H3.
What are the key properties of N-ethyl-1-(3,4,5-trimethylpyrazol-1-yl)pentan-2-amine?
N-ethyl-1-(3,4,5-trimethylpyrazol-1-yl)pentan-2-amine has a molecular weight of 223.36 g/mol, XLogP of 2.59, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1-(3,4,5-trimethylpyrazol-1-yl)pentan-2-amine is sourced from PubChem (CID 62043193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).