C11H17N5 — CID 62043687
5-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)pentan-1-amine (PubChem CID 62043687) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 5-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)pentan-1-amine.
| Compound Name | 5-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)pentan-1-amine |
|---|---|
| PubChem CID | 62043687 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 5-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)pentan-1-amine |
| SMILES | Cc1ccc2nnc(CCCCCN)n2n1 |
| InChI | InChI=1S/C11H17N5/c1-9-6-7-11-14-13-10(16(11)15-9)5-3-2-4-8-12/h6-7H,2-5,8,12H2,1H3 |
| InChIKey | ACOWZGNZJDZMBO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|