C14H18O2 — CID 62044058
1-(2-prop-2-enylphenoxy)pentan-2-one (PubChem CID 62044058) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(2-prop-2-enylphenoxy)pentan-2-one.
| Compound Name | 1-(2-prop-2-enylphenoxy)pentan-2-one |
|---|---|
| PubChem CID | 62044058 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1-(2-prop-2-enylphenoxy)pentan-2-one |
| SMILES | C=CCc1ccccc1OCC(=O)CCC |
| InChI | InChI=1S/C14H18O2/c1-3-7-12-9-5-6-10-14(12)16-11-13(15)8-4-2/h3,5-6,9-10H,1,4,7-8,11H2,2H3 |
| InChIKey | HPXIDESIGRJVDT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|