About 2-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethyl]sulfanylacetonitrile
2-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethyl]sulfanylacetonitrile (PubChem CID 62045396) has the molecular formula C9H13N3O2S
and a molecular weight of 227.29 g/mol. Its IUPAC name is 2-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethyl]sulfanylacetonitrile.
Molecular Properties
| Compound Name | 2-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethyl]sulfanylacetonitrile |
| PubChem CID | 62045396 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethyl]sulfanylacetonitrile |
| SMILES | N#CCSCC(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C9H13N3O2S/c10-2-6-15-7-9(14)12-4-1-8(13)11-3-5-12/h1,3-7H2,(H,11,13) |
| InChIKey | WNKAQXOJNYJLGG-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethyl]sulfanylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethyl]sulfanylacetonitrile?
The IUPAC name of 2-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethyl]sulfanylacetonitrile (CID 62045396) is 2-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethyl]sulfanylacetonitrile.
What is the SMILES notation for 2-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethyl]sulfanylacetonitrile?
The canonical SMILES for 2-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethyl]sulfanylacetonitrile is N#CCSCC(=O)N1CCNC(=O)CC1.
What is the InChIKey of 2-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethyl]sulfanylacetonitrile?
The InChIKey is WNKAQXOJNYJLGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2S/c10-2-6-15-7-9(14)12-4-1-8(13)11-3-5-12/h1,3-7H2,(H,11,13).
What are the key properties of 2-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethyl]sulfanylacetonitrile?
2-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethyl]sulfanylacetonitrile has a molecular weight of 227.29 g/mol, XLogP of -0.41, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethyl]sulfanylacetonitrile is sourced from PubChem (CID 62045396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).