About N-cyclohexyl-1,3-thiazole-4-carboxamide
N-cyclohexyl-1,3-thiazole-4-carboxamide (PubChem CID 62045802) has the molecular formula C10H14N2OS
and a molecular weight of 210.30 g/mol. Its IUPAC name is N-cyclohexyl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-1,3-thiazole-4-carboxamide |
| PubChem CID | 62045802 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | N-cyclohexyl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cscn1 |
| InChI | InChI=1S/C10H14N2OS/c13-10(9-6-14-7-11-9)12-8-4-2-1-3-5-8/h6-8H,1-5H2,(H,12,13) |
| InChIKey | OVKIHOFCHGDJQM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-1,3-thiazole-4-carboxamide?
The IUPAC name of N-cyclohexyl-1,3-thiazole-4-carboxamide (CID 62045802) is N-cyclohexyl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-cyclohexyl-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-cyclohexyl-1,3-thiazole-4-carboxamide is O=C(NC1CCCCC1)c1cscn1.
What is the InChIKey of N-cyclohexyl-1,3-thiazole-4-carboxamide?
The InChIKey is OVKIHOFCHGDJQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2OS/c13-10(9-6-14-7-11-9)12-8-4-2-1-3-5-8/h6-8H,1-5H2,(H,12,13).
What are the key properties of N-cyclohexyl-1,3-thiazole-4-carboxamide?
N-cyclohexyl-1,3-thiazole-4-carboxamide has a molecular weight of 210.30 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 62045802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).