About N-cycloheptyl-1,3-thiazole-4-carboxamide
N-cycloheptyl-1,3-thiazole-4-carboxamide (PubChem CID 62046160) has the molecular formula C11H16N2OS
and a molecular weight of 224.33 g/mol. Its IUPAC name is N-cycloheptyl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-cycloheptyl-1,3-thiazole-4-carboxamide |
| PubChem CID | 62046160 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-cycloheptyl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CCCCCC1)c1cscn1 |
| InChI | InChI=1S/C11H16N2OS/c14-11(10-7-15-8-12-10)13-9-5-3-1-2-4-6-9/h7-9H,1-6H2,(H,13,14) |
| InChIKey | AMBIAKJXMAGRLQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cycloheptyl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-1,3-thiazole-4-carboxamide?
The IUPAC name of N-cycloheptyl-1,3-thiazole-4-carboxamide (CID 62046160) is N-cycloheptyl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-cycloheptyl-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-cycloheptyl-1,3-thiazole-4-carboxamide is O=C(NC1CCCCCC1)c1cscn1.
What is the InChIKey of N-cycloheptyl-1,3-thiazole-4-carboxamide?
The InChIKey is AMBIAKJXMAGRLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2OS/c14-11(10-7-15-8-12-10)13-9-5-3-1-2-4-6-9/h7-9H,1-6H2,(H,13,14).
What are the key properties of N-cycloheptyl-1,3-thiazole-4-carboxamide?
N-cycloheptyl-1,3-thiazole-4-carboxamide has a molecular weight of 224.33 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 62046160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).