C14H16N2O4 — CID 62046592
1-(2,3-dihydro-1,4-benzodioxine-5-carbonyl)-1,4-diazepan-5-one (PubChem CID 62046592) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxine-5-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxine-5-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 62046592 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxine-5-carbonyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)c2cccc3c2OCCO3)CCN1 |
| InChI | InChI=1S/C14H16N2O4/c17-12-4-6-16(7-5-15-12)14(18)10-2-1-3-11-13(10)20-9-8-19-11/h1-3H,4-9H2,(H,15,17) |
| InChIKey | CPHIXEASIGKMPE-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |