C15H20ClFN2O — CID 62046898
2-(2-chloro-6-fluorophenyl)-N-(1-piperidin-3-ylethyl)acetamide (PubChem CID 62046898) has the molecular formula C15H20ClFN2O and a molecular weight of 298.79 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-(1-piperidin-3-ylethyl)acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-(1-piperidin-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 62046898 |
| Molecular Formula | C15H20ClFN2O |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-(1-piperidin-3-ylethyl)acetamide |
| SMILES | CC(NC(=O)Cc1c(F)cccc1Cl)C1CCCNC1 |
| InChI | InChI=1S/C15H20ClFN2O/c1-10(11-4-3-7-18-9-11)19-15(20)8-12-13(16)5-2-6-14(12)17/h2,5-6,10-11,18H,3-4,7-9H2,1H3,(H,19,20) |
| InChIKey | VSHXNKLMQQLSHH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |