About N,N-dipropylethanimidamide
N,N-dipropylethanimidamide (PubChem CID 62047941) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is N,N-dipropylethanimidamide.
Molecular Properties
| Compound Name | N,N-dipropylethanimidamide |
| PubChem CID | 62047941 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | N,N-dipropylethanimidamide |
| SMILES | [H]/N=C(\C)N(CCC)CCC |
| InChI | InChI=1S/C8H18N2/c1-4-6-10(7-5-2)8(3)9/h9H,4-7H2,1-3H3/b9-8+ |
| InChIKey | NCEHBEWJERYLDC-CMDGGOBGSA-N |
| XLogP | 2.11 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dipropylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dipropylethanimidamide?
The IUPAC name of N,N-dipropylethanimidamide (CID 62047941) is N,N-dipropylethanimidamide.
What is the SMILES notation for N,N-dipropylethanimidamide?
The canonical SMILES for N,N-dipropylethanimidamide is [H]/N=C(\C)N(CCC)CCC.
What is the InChIKey of N,N-dipropylethanimidamide?
The InChIKey is NCEHBEWJERYLDC-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H18N2/c1-4-6-10(7-5-2)8(3)9/h9H,4-7H2,1-3H3/b9-8+.
What are the key properties of N,N-dipropylethanimidamide?
N,N-dipropylethanimidamide has a molecular weight of 142.25 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dipropylethanimidamide is sourced from PubChem (CID 62047941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).