C14H20BrN3 — CID 62047954
4-(5-bromo-1-ethylbenzimidazol-2-yl)-2-methylbutan-2-amine (PubChem CID 62047954) has the molecular formula C14H20BrN3 and a molecular weight of 310.24 g/mol. Its IUPAC name is 4-(5-bromo-1-ethylbenzimidazol-2-yl)-2-methylbutan-2-amine.
| Compound Name | 4-(5-bromo-1-ethylbenzimidazol-2-yl)-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 62047954 |
| Molecular Formula | C14H20BrN3 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-(5-bromo-1-ethylbenzimidazol-2-yl)-2-methylbutan-2-amine |
| SMILES | CCn1c(CCC(C)(C)N)nc2cc(Br)ccc21 |
| InChI | InChI=1S/C14H20BrN3/c1-4-18-12-6-5-10(15)9-11(12)17-13(18)7-8-14(2,3)16/h5-6,9H,4,7-8,16H2,1-3H3 |
| InChIKey | GAHYEYXJNDLYGL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |