About N,N-dipropylbutanimidamide
N,N-dipropylbutanimidamide (PubChem CID 62048118) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is N,N-dipropylbutanimidamide.
Molecular Properties
| Compound Name | N,N-dipropylbutanimidamide |
| PubChem CID | 62048118 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | N,N-dipropylbutanimidamide |
| SMILES | [H]/N=C(\CCC)N(CCC)CCC |
| InChI | InChI=1S/C10H22N2/c1-4-7-10(11)12(8-5-2)9-6-3/h11H,4-9H2,1-3H3/b11-10+ |
| InChIKey | LVXHITFMDGAYLY-ZHACJKMWSA-N |
| XLogP | 2.89 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dipropylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dipropylbutanimidamide?
The IUPAC name of N,N-dipropylbutanimidamide (CID 62048118) is N,N-dipropylbutanimidamide.
What is the SMILES notation for N,N-dipropylbutanimidamide?
The canonical SMILES for N,N-dipropylbutanimidamide is [H]/N=C(\CCC)N(CCC)CCC.
What is the InChIKey of N,N-dipropylbutanimidamide?
The InChIKey is LVXHITFMDGAYLY-ZHACJKMWSA-N. The full InChI is InChI=1S/C10H22N2/c1-4-7-10(11)12(8-5-2)9-6-3/h11H,4-9H2,1-3H3/b11-10+.
What are the key properties of N,N-dipropylbutanimidamide?
N,N-dipropylbutanimidamide has a molecular weight of 170.30 g/mol, XLogP of 2.89, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dipropylbutanimidamide is sourced from PubChem (CID 62048118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).