About 2-(2-methoxyphenyl)-N'-propylethanimidamide
2-(2-methoxyphenyl)-N'-propylethanimidamide (PubChem CID 62049614) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-N'-propylethanimidamide.
Molecular Properties
| Compound Name | 2-(2-methoxyphenyl)-N'-propylethanimidamide |
| PubChem CID | 62049614 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-(2-methoxyphenyl)-N'-propylethanimidamide |
| SMILES | CCC/N=C(\N)Cc1ccccc1OC |
| InChI | InChI=1S/C12H18N2O/c1-3-8-14-12(13)9-10-6-4-5-7-11(10)15-2/h4-7H,3,8-9H2,1-2H3,(H2,13,14) |
| InChIKey | SNYHZSWFMWLWIF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyphenyl)-N'-propylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyphenyl)-N'-propylethanimidamide?
The IUPAC name of 2-(2-methoxyphenyl)-N'-propylethanimidamide (CID 62049614) is 2-(2-methoxyphenyl)-N'-propylethanimidamide.
What is the SMILES notation for 2-(2-methoxyphenyl)-N'-propylethanimidamide?
The canonical SMILES for 2-(2-methoxyphenyl)-N'-propylethanimidamide is CCC/N=C(\N)Cc1ccccc1OC.
What is the InChIKey of 2-(2-methoxyphenyl)-N'-propylethanimidamide?
The InChIKey is SNYHZSWFMWLWIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O/c1-3-8-14-12(13)9-10-6-4-5-7-11(10)15-2/h4-7H,3,8-9H2,1-2H3,(H2,13,14).
What are the key properties of 2-(2-methoxyphenyl)-N'-propylethanimidamide?
2-(2-methoxyphenyl)-N'-propylethanimidamide has a molecular weight of 206.29 g/mol, XLogP of 2.00, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyphenyl)-N'-propylethanimidamide is sourced from PubChem (CID 62049614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).