About N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]oxane-4-sulfonamide
N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]oxane-4-sulfonamide (PubChem CID 62049751) has the molecular formula C15H22N2O3S
and a molecular weight of 310.42 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]oxane-4-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]oxane-4-sulfonamide |
| PubChem CID | 62049751 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]oxane-4-sulfonamide |
| SMILES | O=S(=O)(NCCC1CNc2ccccc21)C1CCOCC1 |
| InChI | InChI=1S/C15H22N2O3S/c18-21(19,13-6-9-20-10-7-13)17-8-5-12-11-16-15-4-2-1-3-14(12)15/h1-4,12-13,16-17H,5-11H2 |
| InChIKey | BULBYSLOVIANOF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]oxane-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]oxane-4-sulfonamide?
The IUPAC name of N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]oxane-4-sulfonamide (CID 62049751) is N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]oxane-4-sulfonamide.
What is the SMILES notation for N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]oxane-4-sulfonamide?
The canonical SMILES for N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]oxane-4-sulfonamide is O=S(=O)(NCCC1CNc2ccccc21)C1CCOCC1.
What is the InChIKey of N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]oxane-4-sulfonamide?
The InChIKey is BULBYSLOVIANOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3S/c18-21(19,13-6-9-20-10-7-13)17-8-5-12-11-16-15-4-2-1-3-14(12)15/h1-4,12-13,16-17H,5-11H2.
What are the key properties of N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]oxane-4-sulfonamide?
N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]oxane-4-sulfonamide has a molecular weight of 310.42 g/mol, XLogP of 1.68, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]oxane-4-sulfonamide is sourced from PubChem (CID 62049751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).