C17H20N2O — CID 62050830
4-[methyl(pyridin-2-ylmethyl)amino]-1-phenylbutan-1-one (PubChem CID 62050830) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-[methyl(pyridin-2-ylmethyl)amino]-1-phenylbutan-1-one.
| Compound Name | 4-[methyl(pyridin-2-ylmethyl)amino]-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 62050830 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 4-[methyl(pyridin-2-ylmethyl)amino]-1-phenylbutan-1-one |
| SMILES | CN(CCCC(=O)c1ccccc1)Cc1ccccn1 |
| InChI | InChI=1S/C17H20N2O/c1-19(14-16-10-5-6-12-18-16)13-7-11-17(20)15-8-3-2-4-9-15/h2-6,8-10,12H,7,11,13-14H2,1H3 |
| InChIKey | SCDKPCPTNYFRPU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |