C14H18ClNOS — CID 62052545
1-(3-chlorophenyl)-2-[methyl(thiolan-3-yl)amino]propan-1-one (PubChem CID 62052545) has the molecular formula C14H18ClNOS and a molecular weight of 283.82 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[methyl(thiolan-3-yl)amino]propan-1-one.
| Compound Name | 1-(3-chlorophenyl)-2-[methyl(thiolan-3-yl)amino]propan-1-one |
|---|---|
| PubChem CID | 62052545 |
| Molecular Formula | C14H18ClNOS |
| Molecular Weight | 283.82 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[methyl(thiolan-3-yl)amino]propan-1-one |
| SMILES | CC(C(=O)c1cccc(Cl)c1)N(C)C1CCSC1 |
| InChI | InChI=1S/C14H18ClNOS/c1-10(16(2)13-6-7-18-9-13)14(17)11-4-3-5-12(15)8-11/h3-5,8,10,13H,6-7,9H2,1-2H3 |
| InChIKey | VGIAHLHFWUQAOL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.82 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |