About 2-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclopentan-1-one
2-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclopentan-1-one (PubChem CID 62052814) has the molecular formula C10H14N2OS
and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclopentan-1-one.
Molecular Properties
| Compound Name | 2-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclopentan-1-one |
| PubChem CID | 62052814 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 2-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclopentan-1-one |
| SMILES | CN(Cc1cscn1)C1CCCC1=O |
| InChI | InChI=1S/C10H14N2OS/c1-12(5-8-6-14-7-11-8)9-3-2-4-10(9)13/h6-7,9H,2-5H2,1H3 |
| InChIKey | YAWHUBSLKVLLNU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclopentan-1-one?
The IUPAC name of 2-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclopentan-1-one (CID 62052814) is 2-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclopentan-1-one.
What is the SMILES notation for 2-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclopentan-1-one?
The canonical SMILES for 2-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclopentan-1-one is CN(Cc1cscn1)C1CCCC1=O.
What is the InChIKey of 2-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclopentan-1-one?
The InChIKey is YAWHUBSLKVLLNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2OS/c1-12(5-8-6-14-7-11-8)9-3-2-4-10(9)13/h6-7,9H,2-5H2,1H3.
What are the key properties of 2-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclopentan-1-one?
2-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclopentan-1-one has a molecular weight of 210.30 g/mol, XLogP of 1.70, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(1,3-thiazol-4-ylmethyl)amino]cyclopentan-1-one is sourced from PubChem (CID 62052814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).