C14H19FN2O3 — CID 62053081
2-[butyl-[2-(5-fluoro-2-hydroxyphenyl)-2-oxoethyl]amino]acetamide (PubChem CID 62053081) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is 2-[butyl-[2-(5-fluoro-2-hydroxyphenyl)-2-oxoethyl]amino]acetamide.
| Compound Name | 2-[butyl-[2-(5-fluoro-2-hydroxyphenyl)-2-oxoethyl]amino]acetamide |
|---|---|
| PubChem CID | 62053081 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-[butyl-[2-(5-fluoro-2-hydroxyphenyl)-2-oxoethyl]amino]acetamide |
| SMILES | CCCCN(CC(N)=O)CC(=O)c1cc(F)ccc1O |
| InChI | InChI=1S/C14H19FN2O3/c1-2-3-6-17(9-14(16)20)8-13(19)11-7-10(15)4-5-12(11)18/h4-5,7,18H,2-3,6,8-9H2,1H3,(H2,16,20) |
| InChIKey | GQJTYWJWCMUPRL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |