About 2-[[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-methylamino]acetamide
2-[[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-methylamino]acetamide (PubChem CID 62053334) has the molecular formula C9H10Cl2N2O2S
and a molecular weight of 281.16 g/mol. Its IUPAC name is 2-[[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-methylamino]acetamide.
Molecular Properties
| Compound Name | 2-[[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-methylamino]acetamide |
| PubChem CID | 62053334 |
| Molecular Formula | C9H10Cl2N2O2S |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 2-[[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-methylamino]acetamide |
| SMILES | CN(CC(N)=O)CC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H10Cl2N2O2S/c1-13(4-8(12)15)3-6(14)5-2-7(10)16-9(5)11/h2H,3-4H2,1H3,(H2,12,15) |
| InChIKey | HTCFMFJRRDHJDQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-methylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-methylamino]acetamide?
The IUPAC name of 2-[[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-methylamino]acetamide (CID 62053334) is 2-[[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-methylamino]acetamide.
What is the SMILES notation for 2-[[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-methylamino]acetamide?
The canonical SMILES for 2-[[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-methylamino]acetamide is CN(CC(N)=O)CC(=O)c1cc(Cl)sc1Cl.
What is the InChIKey of 2-[[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-methylamino]acetamide?
The InChIKey is HTCFMFJRRDHJDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2N2O2S/c1-13(4-8(12)15)3-6(14)5-2-7(10)16-9(5)11/h2H,3-4H2,1H3,(H2,12,15).
What are the key properties of 2-[[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-methylamino]acetamide?
2-[[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-methylamino]acetamide has a molecular weight of 281.16 g/mol, XLogP of 1.65, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-methylamino]acetamide is sourced from PubChem (CID 62053334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).