About 2-[4-(aminomethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)acetamide
2-[4-(aminomethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 62053809) has the molecular formula C8H10N6OS
and a molecular weight of 238.28 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)acetamide |
| PubChem CID | 62053809 |
| Molecular Formula | C8H10N6OS |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | NCc1cn(CC(=O)Nc2nccs2)nn1 |
| InChI | InChI=1S/C8H10N6OS/c9-3-6-4-14(13-12-6)5-7(15)11-8-10-1-2-16-8/h1-2,4H,3,5,9H2,(H,10,11,15) |
| InChIKey | CGSZMBIYFQMCQM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-(aminomethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(aminomethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-[4-(aminomethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)acetamide (CID 62053809) is 2-[4-(aminomethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-[4-(aminomethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-[4-(aminomethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)acetamide is NCc1cn(CC(=O)Nc2nccs2)nn1.
What is the InChIKey of 2-[4-(aminomethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)acetamide?
The InChIKey is CGSZMBIYFQMCQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N6OS/c9-3-6-4-14(13-12-6)5-7(15)11-8-10-1-2-16-8/h1-2,4H,3,5,9H2,(H,10,11,15).
What are the key properties of 2-[4-(aminomethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)acetamide?
2-[4-(aminomethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)acetamide has a molecular weight of 238.28 g/mol, XLogP of -0.17, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(aminomethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 62053809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).