About [1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]triazol-4-yl]methanamine
[1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]triazol-4-yl]methanamine (PubChem CID 62053944) has the molecular formula C12H13ClN4O2
and a molecular weight of 280.72 g/mol. Its IUPAC name is [1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]triazol-4-yl]methanamine.
Molecular Properties
| Compound Name | [1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]triazol-4-yl]methanamine |
| PubChem CID | 62053944 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | [1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]triazol-4-yl]methanamine |
| SMILES | NCc1cn(Cc2cc(Cl)c3c(c2)OCCO3)nn1 |
| InChI | InChI=1S/C12H13ClN4O2/c13-10-3-8(4-11-12(10)19-2-1-18-11)6-17-7-9(5-14)15-16-17/h3-4,7H,1-2,5-6,14H2 |
| InChIKey | AVOLFOMKJHEOPJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]triazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]triazol-4-yl]methanamine?
The IUPAC name of [1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]triazol-4-yl]methanamine (CID 62053944) is [1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]triazol-4-yl]methanamine.
What is the SMILES notation for [1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]triazol-4-yl]methanamine?
The canonical SMILES for [1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]triazol-4-yl]methanamine is NCc1cn(Cc2cc(Cl)c3c(c2)OCCO3)nn1.
What is the InChIKey of [1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]triazol-4-yl]methanamine?
The InChIKey is AVOLFOMKJHEOPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN4O2/c13-10-3-8(4-11-12(10)19-2-1-18-11)6-17-7-9(5-14)15-16-17/h3-4,7H,1-2,5-6,14H2.
What are the key properties of [1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]triazol-4-yl]methanamine?
[1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]triazol-4-yl]methanamine has a molecular weight of 280.72 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]triazol-4-yl]methanamine is sourced from PubChem (CID 62053944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).