5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid

C8H10F3N3O2 — CID 62054060

IUPAC5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid
SMILESCCCc1c(C(=O)O)nnn1CC(F)(F)F
InChIInChI=1S/C8H10F3N3O2/c1-2-3-5-6(7(15)16)12-13-14(5)4-8(9,10)11/h2-4H2,1H3,(H,15,16)
InChIKeyHNKHKSOMWMVSJD-UHFFFAOYSA-N
MW237.18 g/mol
LogP1.49
Rot. Bonds4

About 5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid

5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid (PubChem CID 62054060) has the molecular formula C8H10F3N3O2 and a molecular weight of 237.18 g/mol. Its IUPAC name is 5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid.

Molecular Properties

Compound Name5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid
PubChem CID62054060
Molecular FormulaC8H10F3N3O2
Molecular Weight237.18 g/mol
Exact Mass237.07
IUPAC Name5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid
SMILESCCCc1c(C(=O)O)nnn1CC(F)(F)F
InChIInChI=1S/C8H10F3N3O2/c1-2-3-5-6(7(15)16)12-13-14(5)4-8(9,10)11/h2-4H2,1H3,(H,15,16)
InChIKeyHNKHKSOMWMVSJD-UHFFFAOYSA-N
XLogP1.49
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.18
LogP ≤ 51.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid?
The IUPAC name of 5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid (CID 62054060) is 5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid.
What is the SMILES notation for 5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid?
The canonical SMILES for 5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid is CCCc1c(C(=O)O)nnn1CC(F)(F)F.
What is the InChIKey of 5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid?
The InChIKey is HNKHKSOMWMVSJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N3O2/c1-2-3-5-6(7(15)16)12-13-14(5)4-8(9,10)11/h2-4H2,1H3,(H,15,16).
What are the key properties of 5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid?
5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid has a molecular weight of 237.18 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propyl-1-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid is sourced from PubChem (CID 62054060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).