About [1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-yl]methanamine
[1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-yl]methanamine (PubChem CID 62054118) has the molecular formula C10H16N6O
and a molecular weight of 236.28 g/mol. Its IUPAC name is [1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-yl]methanamine.
Molecular Properties
| Compound Name | [1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-yl]methanamine |
| PubChem CID | 62054118 |
| Molecular Formula | C10H16N6O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | [1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-yl]methanamine |
| SMILES | CC(C)(C)c1nnc(Cn2cc(CN)nn2)o1 |
| InChI | InChI=1S/C10H16N6O/c1-10(2,3)9-14-13-8(17-9)6-16-5-7(4-11)12-15-16/h5H,4,6,11H2,1-3H3 |
| InChIKey | MQXQVDAOBAHFNO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-yl]methanamine?
The IUPAC name of [1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-yl]methanamine (CID 62054118) is [1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-yl]methanamine.
What is the SMILES notation for [1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-yl]methanamine?
The canonical SMILES for [1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-yl]methanamine is CC(C)(C)c1nnc(Cn2cc(CN)nn2)o1.
What is the InChIKey of [1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-yl]methanamine?
The InChIKey is MQXQVDAOBAHFNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N6O/c1-10(2,3)9-14-13-8(17-9)6-16-5-7(4-11)12-15-16/h5H,4,6,11H2,1-3H3.
What are the key properties of [1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-yl]methanamine?
[1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-yl]methanamine has a molecular weight of 236.28 g/mol, XLogP of 0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-yl]methanamine is sourced from PubChem (CID 62054118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).