C8H11F2N3O2 — CID 62054405
1-(2,2-difluoroethyl)-5-propyltriazole-4-carboxylic acid (PubChem CID 62054405) has the molecular formula C8H11F2N3O2 and a molecular weight of 219.19 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-5-propyltriazole-4-carboxylic acid.
| Compound Name | 1-(2,2-difluoroethyl)-5-propyltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 62054405 |
| Molecular Formula | C8H11F2N3O2 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 1-(2,2-difluoroethyl)-5-propyltriazole-4-carboxylic acid |
| SMILES | CCCc1c(C(=O)O)nnn1CC(F)F |
| InChI | InChI=1S/C8H11F2N3O2/c1-2-3-5-7(8(14)15)11-12-13(5)4-6(9)10/h6H,2-4H2,1H3,(H,14,15) |
| InChIKey | WCJZYQHDEKXTJJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |