C13H11Br2NO — CID 62055358
2-[(2,4-dibromophenoxy)methyl]aniline (PubChem CID 62055358) has the molecular formula C13H11Br2NO and a molecular weight of 357.05 g/mol. Its IUPAC name is 2-[(2,4-dibromophenoxy)methyl]aniline.
| Compound Name | 2-[(2,4-dibromophenoxy)methyl]aniline |
|---|---|
| PubChem CID | 62055358 |
| Molecular Formula | C13H11Br2NO |
| Molecular Weight | 357.05 g/mol |
| Exact Mass | 354.92 |
| IUPAC Name | 2-[(2,4-dibromophenoxy)methyl]aniline |
| SMILES | Nc1ccccc1COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H11Br2NO/c14-10-5-6-13(11(15)7-10)17-8-9-3-1-2-4-12(9)16/h1-7H,8,16H2 |
| InChIKey | YPHDEFDMIKDTAC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.05 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|