C14H18N2O2S2 — CID 62055705
3-[1-[(5-methylthiophen-2-yl)methylamino]ethyl]benzenesulfonamide (PubChem CID 62055705) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-[1-[(5-methylthiophen-2-yl)methylamino]ethyl]benzenesulfonamide.
| Compound Name | 3-[1-[(5-methylthiophen-2-yl)methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 62055705 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 3-[1-[(5-methylthiophen-2-yl)methylamino]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(CNC(C)c2cccc(S(N)(=O)=O)c2)s1 |
| InChI | InChI=1S/C14H18N2O2S2/c1-10-6-7-13(19-10)9-16-11(2)12-4-3-5-14(8-12)20(15,17)18/h3-8,11,16H,9H2,1-2H3,(H2,15,17,18) |
| InChIKey | MEMMREAIAHUUQA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |