C11H11ClN2S — CID 62057687
3-chloro-N-[(5-methylthiophen-2-yl)methyl]pyridin-2-amine (PubChem CID 62057687) has the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. Its IUPAC name is 3-chloro-N-[(5-methylthiophen-2-yl)methyl]pyridin-2-amine.
| Compound Name | 3-chloro-N-[(5-methylthiophen-2-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 62057687 |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 3-chloro-N-[(5-methylthiophen-2-yl)methyl]pyridin-2-amine |
| SMILES | Cc1ccc(CNc2ncccc2Cl)s1 |
| InChI | InChI=1S/C11H11ClN2S/c1-8-4-5-9(15-8)7-14-11-10(12)3-2-6-13-11/h2-6H,7H2,1H3,(H,13,14) |
| InChIKey | XENIDPHLHJHFOZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |