1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid

C12H12N2O2 — CID 62057706

IUPAC1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid
SMILESCc1cc(C)cc(-n2cnc(C(=O)O)c2)c1
InChIInChI=1S/C12H12N2O2/c1-8-3-9(2)5-10(4-8)14-6-11(12(15)16)13-7-14/h3-7H,1-2H3,(H,15,16)
InChIKeyZBEHFWUMQOVJHF-UHFFFAOYSA-N
MW216.24 g/mol
LogP2.19
Rot. Bonds2

About 1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid

1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid (PubChem CID 62057706) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid.

Molecular Properties

Compound Name1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid
PubChem CID62057706
Molecular FormulaC12H12N2O2
Molecular Weight216.24 g/mol
Exact Mass216.09
IUPAC Name1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid
SMILESCc1cc(C)cc(-n2cnc(C(=O)O)c2)c1
InChIInChI=1S/C12H12N2O2/c1-8-3-9(2)5-10(4-8)14-6-11(12(15)16)13-7-14/h3-7H,1-2H3,(H,15,16)
InChIKeyZBEHFWUMQOVJHF-UHFFFAOYSA-N
XLogP2.19
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.24
LogP ≤ 52.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid?
The IUPAC name of 1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid (CID 62057706) is 1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid.
What is the SMILES notation for 1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid?
The canonical SMILES for 1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid is Cc1cc(C)cc(-n2cnc(C(=O)O)c2)c1.
What is the InChIKey of 1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid?
The InChIKey is ZBEHFWUMQOVJHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c1-8-3-9(2)5-10(4-8)14-6-11(12(15)16)13-7-14/h3-7H,1-2H3,(H,15,16).
What are the key properties of 1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid?
1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid has a molecular weight of 216.24 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethylphenyl)imidazole-4-carboxylic acid is sourced from PubChem (CID 62057706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).