About 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid
1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid (PubChem CID 62059432) has the molecular formula C11H14N4O2S
and a molecular weight of 266.33 g/mol. Its IUPAC name is 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid |
| PubChem CID | 62059432 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid |
| SMILES | CC(C)(C)c1nc(Cn2cc(C(=O)O)nn2)cs1 |
| InChI | InChI=1S/C11H14N4O2S/c1-11(2,3)10-12-7(6-18-10)4-15-5-8(9(16)17)13-14-15/h5-6H,4H2,1-3H3,(H,16,17) |
| InChIKey | HAWRBOHZUYRFTD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid?
The IUPAC name of 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid (CID 62059432) is 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid.
What is the SMILES notation for 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid?
The canonical SMILES for 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid is CC(C)(C)c1nc(Cn2cc(C(=O)O)nn2)cs1.
What is the InChIKey of 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid?
The InChIKey is HAWRBOHZUYRFTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2S/c1-11(2,3)10-12-7(6-18-10)4-15-5-8(9(16)17)13-14-15/h5-6H,4H2,1-3H3,(H,16,17).
What are the key properties of 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid?
1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid has a molecular weight of 266.33 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid is sourced from PubChem (CID 62059432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).