About 5-tert-butyl-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid
5-tert-butyl-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid (PubChem CID 62059461) has the molecular formula C12H18F3N3O3
and a molecular weight of 309.29 g/mol. Its IUPAC name is 5-tert-butyl-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-tert-butyl-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid |
| PubChem CID | 62059461 |
| Molecular Formula | C12H18F3N3O3 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 5-tert-butyl-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid |
| SMILES | CC(C)(C)c1c(C(=O)O)nnn1CCCOCC(F)(F)F |
| InChI | InChI=1S/C12H18F3N3O3/c1-11(2,3)9-8(10(19)20)16-17-18(9)5-4-6-21-7-12(13,14)15/h4-7H2,1-3H3,(H,19,20) |
| InChIKey | ZSXUNSQYTHSAEZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid?
The IUPAC name of 5-tert-butyl-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid (CID 62059461) is 5-tert-butyl-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid.
What is the SMILES notation for 5-tert-butyl-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid?
The canonical SMILES for 5-tert-butyl-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid is CC(C)(C)c1c(C(=O)O)nnn1CCCOCC(F)(F)F.
What is the InChIKey of 5-tert-butyl-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid?
The InChIKey is ZSXUNSQYTHSAEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3N3O3/c1-11(2,3)9-8(10(19)20)16-17-18(9)5-4-6-21-7-12(13,14)15/h4-7H2,1-3H3,(H,19,20).
What are the key properties of 5-tert-butyl-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid?
5-tert-butyl-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid has a molecular weight of 309.29 g/mol, XLogP of 2.24, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid is sourced from PubChem (CID 62059461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).