About 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid
1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid (PubChem CID 62059593) has the molecular formula C9H10N4O2S
and a molecular weight of 238.27 g/mol. Its IUPAC name is 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid |
| PubChem CID | 62059593 |
| Molecular Formula | C9H10N4O2S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid |
| SMILES | CCc1nc(Cn2cc(C(=O)O)nn2)cs1 |
| InChI | InChI=1S/C9H10N4O2S/c1-2-8-10-6(5-16-8)3-13-4-7(9(14)15)11-12-13/h4-5H,2-3H2,1H3,(H,14,15) |
| InChIKey | DYTSWHROKUOPBD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid?
The IUPAC name of 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid (CID 62059593) is 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid.
What is the SMILES notation for 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid?
The canonical SMILES for 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid is CCc1nc(Cn2cc(C(=O)O)nn2)cs1.
What is the InChIKey of 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid?
The InChIKey is DYTSWHROKUOPBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2S/c1-2-8-10-6(5-16-8)3-13-4-7(9(14)15)11-12-13/h4-5H,2-3H2,1H3,(H,14,15).
What are the key properties of 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid?
1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid has a molecular weight of 238.27 g/mol, XLogP of 1.04, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazole-4-carboxylic acid is sourced from PubChem (CID 62059593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).