C9H15N3O3 — CID 62060604
5-ethyl-1-(2-hydroxy-2-methylpropyl)triazole-4-carboxylic acid (PubChem CID 62060604) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 5-ethyl-1-(2-hydroxy-2-methylpropyl)triazole-4-carboxylic acid.
| Compound Name | 5-ethyl-1-(2-hydroxy-2-methylpropyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 62060604 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 5-ethyl-1-(2-hydroxy-2-methylpropyl)triazole-4-carboxylic acid |
| SMILES | CCc1c(C(=O)O)nnn1CC(C)(C)O |
| InChI | InChI=1S/C9H15N3O3/c1-4-6-7(8(13)14)10-11-12(6)5-9(2,3)15/h15H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | WGYALCNPBVCMES-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |