About 3-[ethyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]-2-methylpropanethioamide
3-[ethyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]-2-methylpropanethioamide (PubChem CID 62061410) has the molecular formula C12H22N4O2S2
and a molecular weight of 318.47 g/mol. Its IUPAC name is 3-[ethyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]-2-methylpropanethioamide.
Molecular Properties
| Compound Name | 3-[ethyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]-2-methylpropanethioamide |
| PubChem CID | 62061410 |
| Molecular Formula | C12H22N4O2S2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 3-[ethyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]-2-methylpropanethioamide |
| SMILES | CCN(CC(C)C(N)=S)S(=O)(=O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C12H22N4O2S2/c1-6-16(7-8(2)12(13)19)20(17,18)11-9(3)14-15(5)10(11)4/h8H,6-7H2,1-5H3,(H2,13,19) |
| InChIKey | MSZNMDTUJUAZLJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[ethyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]-2-methylpropanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]-2-methylpropanethioamide?
The IUPAC name of 3-[ethyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]-2-methylpropanethioamide (CID 62061410) is 3-[ethyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]-2-methylpropanethioamide.
What is the SMILES notation for 3-[ethyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]-2-methylpropanethioamide?
The canonical SMILES for 3-[ethyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]-2-methylpropanethioamide is CCN(CC(C)C(N)=S)S(=O)(=O)c1c(C)nn(C)c1C.
What is the InChIKey of 3-[ethyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]-2-methylpropanethioamide?
The InChIKey is MSZNMDTUJUAZLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O2S2/c1-6-16(7-8(2)12(13)19)20(17,18)11-9(3)14-15(5)10(11)4/h8H,6-7H2,1-5H3,(H2,13,19).
What are the key properties of 3-[ethyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]-2-methylpropanethioamide?
3-[ethyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]-2-methylpropanethioamide has a molecular weight of 318.47 g/mol, XLogP of 0.97, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl-(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]-2-methylpropanethioamide is sourced from PubChem (CID 62061410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).