About 1-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]cyclopentane-1-carbothioamide
1-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]cyclopentane-1-carbothioamide (PubChem CID 62061579) has the molecular formula C12H20N4O2S2
and a molecular weight of 316.45 g/mol. Its IUPAC name is 1-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]cyclopentane-1-carbothioamide.
Molecular Properties
| Compound Name | 1-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]cyclopentane-1-carbothioamide |
| PubChem CID | 62061579 |
| Molecular Formula | C12H20N4O2S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]cyclopentane-1-carbothioamide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)NC1(C(N)=S)CCCC1 |
| InChI | InChI=1S/C12H20N4O2S2/c1-8-10(9(2)16(3)14-8)20(17,18)15-12(11(13)19)6-4-5-7-12/h15H,4-7H2,1-3H3,(H2,13,19) |
| InChIKey | ZUCSNNYQFVOVBA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]cyclopentane-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]cyclopentane-1-carbothioamide?
The IUPAC name of 1-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]cyclopentane-1-carbothioamide (CID 62061579) is 1-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]cyclopentane-1-carbothioamide.
What is the SMILES notation for 1-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]cyclopentane-1-carbothioamide?
The canonical SMILES for 1-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]cyclopentane-1-carbothioamide is Cc1nn(C)c(C)c1S(=O)(=O)NC1(C(N)=S)CCCC1.
What is the InChIKey of 1-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]cyclopentane-1-carbothioamide?
The InChIKey is ZUCSNNYQFVOVBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O2S2/c1-8-10(9(2)16(3)14-8)20(17,18)15-12(11(13)19)6-4-5-7-12/h15H,4-7H2,1-3H3,(H2,13,19).
What are the key properties of 1-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]cyclopentane-1-carbothioamide?
1-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]cyclopentane-1-carbothioamide has a molecular weight of 316.45 g/mol, XLogP of 0.91, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]cyclopentane-1-carbothioamide is sourced from PubChem (CID 62061579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).