About 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-1-methylpyrazole-4-sulfonamide
3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-1-methylpyrazole-4-sulfonamide (PubChem CID 62063692) has the molecular formula C9H14N6O4S2
and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-1-methylpyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-1-methylpyrazole-4-sulfonamide |
| PubChem CID | 62063692 |
| Molecular Formula | C9H14N6O4S2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-1-methylpyrazole-4-sulfonamide |
| SMILES | Cc1nc(S(=O)(=O)Nc2nn(C)cc2S(N)(=O)=O)cn1C |
| InChI | InChI=1S/C9H14N6O4S2/c1-6-11-8(5-14(6)2)21(18,19)13-9-7(20(10,16)17)4-15(3)12-9/h4-5H,1-3H3,(H,12,13)(H2,10,16,17) |
| InChIKey | QCJOQYQJKCULRM-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 141.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-1-methylpyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-1-methylpyrazole-4-sulfonamide?
The IUPAC name of 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-1-methylpyrazole-4-sulfonamide (CID 62063692) is 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-1-methylpyrazole-4-sulfonamide.
What is the SMILES notation for 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-1-methylpyrazole-4-sulfonamide?
The canonical SMILES for 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-1-methylpyrazole-4-sulfonamide is Cc1nc(S(=O)(=O)Nc2nn(C)cc2S(N)(=O)=O)cn1C.
What is the InChIKey of 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-1-methylpyrazole-4-sulfonamide?
The InChIKey is QCJOQYQJKCULRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N6O4S2/c1-6-11-8(5-14(6)2)21(18,19)13-9-7(20(10,16)17)4-15(3)12-9/h4-5H,1-3H3,(H,12,13)(H2,10,16,17).
What are the key properties of 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-1-methylpyrazole-4-sulfonamide?
3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-1-methylpyrazole-4-sulfonamide has a molecular weight of 334.38 g/mol, XLogP of -1.09, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-1-methylpyrazole-4-sulfonamide is sourced from PubChem (CID 62063692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).