About [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine
[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine (PubChem CID 62063790) has the molecular formula C10H19F3N2O
and a molecular weight of 240.27 g/mol. Its IUPAC name is [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine |
| PubChem CID | 62063790 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine |
| SMILES | NCC1CCN(CCCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C10H19F3N2O/c11-10(12,13)8-16-5-1-3-15-4-2-9(6-14)7-15/h9H,1-8,14H2 |
| InChIKey | OFEYTMNGBFSPDY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine?
The IUPAC name of [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine (CID 62063790) is [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine.
What is the SMILES notation for [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine?
The canonical SMILES for [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine is NCC1CCN(CCCOCC(F)(F)F)C1.
What is the InChIKey of [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine?
The InChIKey is OFEYTMNGBFSPDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2O/c11-10(12,13)8-16-5-1-3-15-4-2-9(6-14)7-15/h9H,1-8,14H2.
What are the key properties of [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine?
[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine has a molecular weight of 240.27 g/mol, XLogP of 1.24, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine is sourced from PubChem (CID 62063790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).