About 4-carbamothioyl-N-[(2,4-difluorophenyl)methyl]benzamide
4-carbamothioyl-N-[(2,4-difluorophenyl)methyl]benzamide (PubChem CID 62063820) has the molecular formula C15H12F2N2OS
and a molecular weight of 306.34 g/mol. Its IUPAC name is 4-carbamothioyl-N-[(2,4-difluorophenyl)methyl]benzamide.
Molecular Properties
| Compound Name | 4-carbamothioyl-N-[(2,4-difluorophenyl)methyl]benzamide |
| PubChem CID | 62063820 |
| Molecular Formula | C15H12F2N2OS |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 4-carbamothioyl-N-[(2,4-difluorophenyl)methyl]benzamide |
| SMILES | NC(=S)c1ccc(C(=O)NCc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C15H12F2N2OS/c16-12-6-5-11(13(17)7-12)8-19-15(20)10-3-1-9(2-4-10)14(18)21/h1-7H,8H2,(H2,18,21)(H,19,20) |
| InChIKey | HJEHVYVAVVPOGS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-carbamothioyl-N-[(2,4-difluorophenyl)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-carbamothioyl-N-[(2,4-difluorophenyl)methyl]benzamide?
The IUPAC name of 4-carbamothioyl-N-[(2,4-difluorophenyl)methyl]benzamide (CID 62063820) is 4-carbamothioyl-N-[(2,4-difluorophenyl)methyl]benzamide.
What is the SMILES notation for 4-carbamothioyl-N-[(2,4-difluorophenyl)methyl]benzamide?
The canonical SMILES for 4-carbamothioyl-N-[(2,4-difluorophenyl)methyl]benzamide is NC(=S)c1ccc(C(=O)NCc2ccc(F)cc2F)cc1.
What is the InChIKey of 4-carbamothioyl-N-[(2,4-difluorophenyl)methyl]benzamide?
The InChIKey is HJEHVYVAVVPOGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2N2OS/c16-12-6-5-11(13(17)7-12)8-19-15(20)10-3-1-9(2-4-10)14(18)21/h1-7H,8H2,(H2,18,21)(H,19,20).
What are the key properties of 4-carbamothioyl-N-[(2,4-difluorophenyl)methyl]benzamide?
4-carbamothioyl-N-[(2,4-difluorophenyl)methyl]benzamide has a molecular weight of 306.34 g/mol, XLogP of 2.53, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-carbamothioyl-N-[(2,4-difluorophenyl)methyl]benzamide is sourced from PubChem (CID 62063820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).