About N-(4-amino-2,6-dibromophenyl)-1-ethyl-2-methylimidazole-4-sulfonamide
N-(4-amino-2,6-dibromophenyl)-1-ethyl-2-methylimidazole-4-sulfonamide (PubChem CID 62064056) has the molecular formula C12H14Br2N4O2S
and a molecular weight of 438.15 g/mol. Its IUPAC name is N-(4-amino-2,6-dibromophenyl)-1-ethyl-2-methylimidazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(4-amino-2,6-dibromophenyl)-1-ethyl-2-methylimidazole-4-sulfonamide |
| PubChem CID | 62064056 |
| Molecular Formula | C12H14Br2N4O2S |
| Molecular Weight | 438.15 g/mol |
| Exact Mass | 435.92 |
| IUPAC Name | N-(4-amino-2,6-dibromophenyl)-1-ethyl-2-methylimidazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)Nc2c(Br)cc(N)cc2Br)nc1C |
| InChI | InChI=1S/C12H14Br2N4O2S/c1-3-18-6-11(16-7(18)2)21(19,20)17-12-9(13)4-8(15)5-10(12)14/h4-6,17H,3,15H2,1-2H3 |
| InChIKey | PAXOVLVSQPANBQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.15 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(4-amino-2,6-dibromophenyl)-1-ethyl-2-methylimidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-2,6-dibromophenyl)-1-ethyl-2-methylimidazole-4-sulfonamide?
The IUPAC name of N-(4-amino-2,6-dibromophenyl)-1-ethyl-2-methylimidazole-4-sulfonamide (CID 62064056) is N-(4-amino-2,6-dibromophenyl)-1-ethyl-2-methylimidazole-4-sulfonamide.
What is the SMILES notation for N-(4-amino-2,6-dibromophenyl)-1-ethyl-2-methylimidazole-4-sulfonamide?
The canonical SMILES for N-(4-amino-2,6-dibromophenyl)-1-ethyl-2-methylimidazole-4-sulfonamide is CCn1cc(S(=O)(=O)Nc2c(Br)cc(N)cc2Br)nc1C.
What is the InChIKey of N-(4-amino-2,6-dibromophenyl)-1-ethyl-2-methylimidazole-4-sulfonamide?
The InChIKey is PAXOVLVSQPANBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Br2N4O2S/c1-3-18-6-11(16-7(18)2)21(19,20)17-12-9(13)4-8(15)5-10(12)14/h4-6,17H,3,15H2,1-2H3.
What are the key properties of N-(4-amino-2,6-dibromophenyl)-1-ethyl-2-methylimidazole-4-sulfonamide?
N-(4-amino-2,6-dibromophenyl)-1-ethyl-2-methylimidazole-4-sulfonamide has a molecular weight of 438.15 g/mol, XLogP of 3.12, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-2,6-dibromophenyl)-1-ethyl-2-methylimidazole-4-sulfonamide is sourced from PubChem (CID 62064056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).