About 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylpropanamide
2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylpropanamide (PubChem CID 62064201) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylpropanamide |
| PubChem CID | 62064201 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylpropanamide |
| SMILES | CC(NCC1CCC=CO1)C(=O)N(C)C |
| InChI | InChI=1S/C11H20N2O2/c1-9(11(14)13(2)3)12-8-10-6-4-5-7-15-10/h5,7,9-10,12H,4,6,8H2,1-3H3 |
| InChIKey | JHBZECJKOOEELH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylpropanamide?
The IUPAC name of 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylpropanamide (CID 62064201) is 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylpropanamide.
What is the SMILES notation for 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylpropanamide?
The canonical SMILES for 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylpropanamide is CC(NCC1CCC=CO1)C(=O)N(C)C.
What is the InChIKey of 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylpropanamide?
The InChIKey is JHBZECJKOOEELH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2/c1-9(11(14)13(2)3)12-8-10-6-4-5-7-15-10/h5,7,9-10,12H,4,6,8H2,1-3H3.
What are the key properties of 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylpropanamide?
2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylpropanamide has a molecular weight of 212.29 g/mol, XLogP of 0.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylpropanamide is sourced from PubChem (CID 62064201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).