About 2-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]acetamide
2-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]acetamide (PubChem CID 62064229) has the molecular formula C13H23N3O2
and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]acetamide |
| PubChem CID | 62064229 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCC(NCC2CCC=CO2)CC1 |
| InChI | InChI=1S/C13H23N3O2/c14-13(17)10-16-6-4-11(5-7-16)15-9-12-3-1-2-8-18-12/h2,8,11-12,15H,1,3-7,9-10H2,(H2,14,17) |
| InChIKey | JNOAGXDJPLJSOY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]acetamide?
The IUPAC name of 2-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]acetamide (CID 62064229) is 2-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]acetamide.
What is the SMILES notation for 2-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]acetamide?
The canonical SMILES for 2-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]acetamide is NC(=O)CN1CCC(NCC2CCC=CO2)CC1.
What is the InChIKey of 2-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]acetamide?
The InChIKey is JNOAGXDJPLJSOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2/c14-13(17)10-16-6-4-11(5-7-16)15-9-12-3-1-2-8-18-12/h2,8,11-12,15H,1,3-7,9-10H2,(H2,14,17).
What are the key properties of 2-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]acetamide?
2-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]acetamide has a molecular weight of 253.35 g/mol, XLogP of 0.22, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)piperidin-1-yl]acetamide is sourced from PubChem (CID 62064229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).