About 2-cyclohexyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)ethanamine
2-cyclohexyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)ethanamine (PubChem CID 62064921) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-cyclohexyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)ethanamine.
Molecular Properties
| Compound Name | 2-cyclohexyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)ethanamine |
| PubChem CID | 62064921 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 2-cyclohexyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)ethanamine |
| SMILES | C1=COC(CNCCC2CCCCC2)CC1 |
| InChI | InChI=1S/C14H25NO/c1-2-6-13(7-3-1)9-10-15-12-14-8-4-5-11-16-14/h5,11,13-15H,1-4,6-10,12H2 |
| InChIKey | GRVRJHSSJRNUCW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)ethanamine?
The IUPAC name of 2-cyclohexyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)ethanamine (CID 62064921) is 2-cyclohexyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)ethanamine.
What is the SMILES notation for 2-cyclohexyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)ethanamine?
The canonical SMILES for 2-cyclohexyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)ethanamine is C1=COC(CNCCC2CCCCC2)CC1.
What is the InChIKey of 2-cyclohexyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)ethanamine?
The InChIKey is GRVRJHSSJRNUCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO/c1-2-6-13(7-3-1)9-10-15-12-14-8-4-5-11-16-14/h5,11,13-15H,1-4,6-10,12H2.
What are the key properties of 2-cyclohexyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)ethanamine?
2-cyclohexyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)ethanamine has a molecular weight of 223.36 g/mol, XLogP of 3.24, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)ethanamine is sourced from PubChem (CID 62064921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).