About 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylacetamide
2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylacetamide (PubChem CID 62065786) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylacetamide |
| PubChem CID | 62065786 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNCC1CCC=CO1 |
| InChI | InChI=1S/C10H18N2O2/c1-12(2)10(13)8-11-7-9-5-3-4-6-14-9/h4,6,9,11H,3,5,7-8H2,1-2H3 |
| InChIKey | OVXOIAKOILNLAI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylacetamide?
The IUPAC name of 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylacetamide (CID 62065786) is 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylacetamide?
The canonical SMILES for 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylacetamide is CN(C)C(=O)CNCC1CCC=CO1.
What is the InChIKey of 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylacetamide?
The InChIKey is OVXOIAKOILNLAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-12(2)10(13)8-11-7-9-5-3-4-6-14-9/h4,6,9,11H,3,5,7-8H2,1-2H3.
What are the key properties of 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylacetamide?
2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylacetamide has a molecular weight of 198.27 g/mol, XLogP of 0.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N,N-dimethylacetamide is sourced from PubChem (CID 62065786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).