C16H20N2O — CID 62065957
N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2-(1H-indol-3-yl)ethanamine (PubChem CID 62065957) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2-(1H-indol-3-yl)ethanamine.
| Compound Name | N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 62065957 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2-(1H-indol-3-yl)ethanamine |
| SMILES | C1=COC(CNCCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C16H20N2O/c1-2-7-16-15(6-1)13(11-18-16)8-9-17-12-14-5-3-4-10-19-14/h1-2,4,6-7,10-11,14,17-18H,3,5,8-9,12H2 |
| InChIKey | NYYRYDHHXSSDLV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|