C11H16F2N2O — CID 62066384
1-[2-(difluoromethoxy)phenyl]-N-ethylethane-1,2-diamine (PubChem CID 62066384) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)phenyl]-N-ethylethane-1,2-diamine.
| Compound Name | 1-[2-(difluoromethoxy)phenyl]-N-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 62066384 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-[2-(difluoromethoxy)phenyl]-N-ethylethane-1,2-diamine |
| SMILES | CCNC(CN)c1ccccc1OC(F)F |
| InChI | InChI=1S/C11H16F2N2O/c1-2-15-9(7-14)8-5-3-4-6-10(8)16-11(12)13/h3-6,9,11,15H,2,7,14H2,1H3 |
| InChIKey | COEMELRGEWEPCY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |