About N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(2-methylpiperidin-1-yl)propan-1-amine
N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(2-methylpiperidin-1-yl)propan-1-amine (PubChem CID 62066697) has the molecular formula C15H28N2O
and a molecular weight of 252.40 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(2-methylpiperidin-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(2-methylpiperidin-1-yl)propan-1-amine |
| PubChem CID | 62066697 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(2-methylpiperidin-1-yl)propan-1-amine |
| SMILES | CC1CCCCN1CCCNCC1CCC=CO1 |
| InChI | InChI=1S/C15H28N2O/c1-14-7-2-4-10-17(14)11-6-9-16-13-15-8-3-5-12-18-15/h5,12,14-16H,2-4,6-11,13H2,1H3 |
| InChIKey | JBPJHGIUSJISBB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(2-methylpiperidin-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(2-methylpiperidin-1-yl)propan-1-amine?
The IUPAC name of N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(2-methylpiperidin-1-yl)propan-1-amine (CID 62066697) is N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(2-methylpiperidin-1-yl)propan-1-amine.
What is the SMILES notation for N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(2-methylpiperidin-1-yl)propan-1-amine?
The canonical SMILES for N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(2-methylpiperidin-1-yl)propan-1-amine is CC1CCCCN1CCCNCC1CCC=CO1.
What is the InChIKey of N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(2-methylpiperidin-1-yl)propan-1-amine?
The InChIKey is JBPJHGIUSJISBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O/c1-14-7-2-4-10-17(14)11-6-9-16-13-15-8-3-5-12-18-15/h5,12,14-16H,2-4,6-11,13H2,1H3.
What are the key properties of N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(2-methylpiperidin-1-yl)propan-1-amine?
N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(2-methylpiperidin-1-yl)propan-1-amine has a molecular weight of 252.40 g/mol, XLogP of 2.53, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(2-methylpiperidin-1-yl)propan-1-amine is sourced from PubChem (CID 62066697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).