C9H16N2O2 — CID 62066714
3-(3,4-dihydro-2H-pyran-2-ylmethylamino)propanamide (PubChem CID 62066714) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-pyran-2-ylmethylamino)propanamide.
| Compound Name | 3-(3,4-dihydro-2H-pyran-2-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 62066714 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 3-(3,4-dihydro-2H-pyran-2-ylmethylamino)propanamide |
| SMILES | NC(=O)CCNCC1CCC=CO1 |
| InChI | InChI=1S/C9H16N2O2/c10-9(12)4-5-11-7-8-3-1-2-6-13-8/h2,6,8,11H,1,3-5,7H2,(H2,10,12) |
| InChIKey | DEYIYMKCDQCWAX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|